C12H7BrF8O2 — CID 91728334
2,2,3,3,4,4,5,5-octafluoropentyl 3-bromobenzoate (PubChem CID 91728334) has the molecular formula C12H7BrF8O2 and a molecular weight of 415.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 3-bromobenzoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 3-bromobenzoate |
|---|---|
| PubChem CID | 91728334 |
| Molecular Formula | C12H7BrF8O2 |
| Molecular Weight | 415.07 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 3-bromobenzoate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H7BrF8O2/c13-7-3-1-2-6(4-7)8(22)23-5-10(16,17)12(20,21)11(18,19)9(14)15/h1-4,9H,5H2 |
| InChIKey | PCXNEAYFCQQGHJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.07 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|