C6H13N5OSi — CID 91728592
6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine (PubChem CID 91728592) has the molecular formula C6H13N5OSi and a molecular weight of 199.29 g/mol. Its IUPAC name is 6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91728592 |
| Molecular Formula | C6H13N5OSi |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine |
| SMILES | C[Si](C)(C)Oc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C6H13N5OSi/c1-13(2,3)12-6-10-4(7)9-5(8)11-6/h1-3H3,(H4,7,8,9,10,11) |
| InChIKey | HEKVMVWSPMZRGH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|