About 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate
10-O-but-3-yn-2-yl 1-O-nonyl decanedioate (PubChem CID 91728687) has the molecular formula C23H40O4
and a molecular weight of 380.57 g/mol. Its IUPAC name is 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate.
Molecular Properties
| Compound Name | 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate |
| PubChem CID | 91728687 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate |
| SMILES | C#CC(C)OC(=O)CCCCCCCCC(=O)OCCCCCCCCC |
| InChI | InChI=1S/C23H40O4/c1-4-6-7-8-11-14-17-20-26-22(24)18-15-12-9-10-13-16-19-23(25)27-21(3)5-2/h2,21H,4,6-20H2,1,3H3 |
| InChIKey | WETSOVSQDZZPPT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate?
The IUPAC name of 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate (CID 91728687) is 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate.
What is the SMILES notation for 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate?
The canonical SMILES for 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate is C#CC(C)OC(=O)CCCCCCCCC(=O)OCCCCCCCCC.
What is the InChIKey of 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate?
The InChIKey is WETSOVSQDZZPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40O4/c1-4-6-7-8-11-14-17-20-26-22(24)18-15-12-9-10-13-16-19-23(25)27-21(3)5-2/h2,21H,4,6-20H2,1,3H3.
What are the key properties of 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate?
10-O-but-3-yn-2-yl 1-O-nonyl decanedioate has a molecular weight of 380.57 g/mol, XLogP of 5.97, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-O-but-3-yn-2-yl 1-O-nonyl decanedioate is sourced from PubChem (CID 91728687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).