About 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate
10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate (PubChem CID 91728738) has the molecular formula C21H38O4
and a molecular weight of 354.53 g/mol. Its IUPAC name is 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate.
Molecular Properties
| Compound Name | 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate |
| PubChem CID | 91728738 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate |
| SMILES | C=CCCCOC(=O)CCCCCCCCC(=O)OCCCC(C)C |
| InChI | InChI=1S/C21H38O4/c1-4-5-12-17-24-20(22)15-10-8-6-7-9-11-16-21(23)25-18-13-14-19(2)3/h4,19H,1,5-18H2,2-3H3 |
| InChIKey | GDHUKBZWNJOMLD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate?
The IUPAC name of 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate (CID 91728738) is 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate.
What is the SMILES notation for 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate?
The canonical SMILES for 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate is C=CCCCOC(=O)CCCCCCCCC(=O)OCCCC(C)C.
What is the InChIKey of 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate?
The InChIKey is GDHUKBZWNJOMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O4/c1-4-5-12-17-24-20(22)15-10-8-6-7-9-11-16-21(23)25-18-13-14-19(2)3/h4,19H,1,5-18H2,2-3H3.
What are the key properties of 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate?
10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate has a molecular weight of 354.53 g/mol, XLogP of 5.60, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-O-(4-methylpentyl) 1-O-pent-4-enyl decanedioate is sourced from PubChem (CID 91728738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).