About 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate
1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate (PubChem CID 91728753) has the molecular formula C22H40O4
and a molecular weight of 368.56 g/mol. Its IUPAC name is 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate.
Molecular Properties
| Compound Name | 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate |
| PubChem CID | 91728753 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate |
| SMILES | CCCCCCCOC(=O)CCCCCCCCC(=O)OCC=C(C)C |
| InChI | InChI=1S/C22H40O4/c1-4-5-6-11-14-18-25-21(23)15-12-9-7-8-10-13-16-22(24)26-19-17-20(2)3/h17H,4-16,18-19H2,1-3H3 |
| InChIKey | HZTXVCIVIQHSER-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate?
The IUPAC name of 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate (CID 91728753) is 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate.
What is the SMILES notation for 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate?
The canonical SMILES for 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate is CCCCCCCOC(=O)CCCCCCCCC(=O)OCC=C(C)C.
What is the InChIKey of 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate?
The InChIKey is HZTXVCIVIQHSER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O4/c1-4-5-6-11-14-18-25-21(23)15-12-9-7-8-10-13-16-22(24)26-19-17-20(2)3/h17H,4-16,18-19H2,1-3H3.
What are the key properties of 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate?
1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate has a molecular weight of 368.56 g/mol, XLogP of 6.13, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-heptyl 10-O-(3-methylbut-2-enyl) decanedioate is sourced from PubChem (CID 91728753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).