About 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate
1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate (PubChem CID 91728900) has the molecular formula C29H54O4
and a molecular weight of 466.75 g/mol. Its IUPAC name is 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate.
Molecular Properties
| Compound Name | 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate |
| PubChem CID | 91728900 |
| Molecular Formula | C29H54O4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate |
| SMILES | CCCCC/C=C\CCOC(=O)CCCCCCCCC(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C29H54O4/c1-3-5-7-9-11-15-19-23-27-33-29(31)25-21-17-13-12-16-20-24-28(30)32-26-22-18-14-10-8-6-4-2/h14,18H,3-13,15-17,19-27H2,1-2H3/b18-14- |
| InChIKey | UJUIANVLGPQDQS-JXAWBTAJSA-N |
| XLogP | 8.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate?
The IUPAC name of 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate (CID 91728900) is 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate.
What is the SMILES notation for 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate?
The canonical SMILES for 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate is CCCCC/C=C\CCOC(=O)CCCCCCCCC(=O)OCCCCCCCCCC.
What is the InChIKey of 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate?
The InChIKey is UJUIANVLGPQDQS-JXAWBTAJSA-N. The full InChI is InChI=1S/C29H54O4/c1-3-5-7-9-11-15-19-23-27-33-29(31)25-21-17-13-12-16-20-24-28(30)32-26-22-18-14-10-8-6-4-2/h14,18H,3-13,15-17,19-27H2,1-2H3/b18-14-.
What are the key properties of 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate?
1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate has a molecular weight of 466.75 g/mol, XLogP of 8.86, 25 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-decyl 10-O-[(Z)-non-3-enyl] decanedioate is sourced from PubChem (CID 91728900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).