About 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate
1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate (PubChem CID 91729054) has the molecular formula C21H30BrFO4
and a molecular weight of 445.37 g/mol. Its IUPAC name is 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate.
Molecular Properties
| Compound Name | 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate |
| PubChem CID | 91729054 |
| Molecular Formula | C21H30BrFO4 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate |
| SMILES | CC(C)COC(=O)CCCCCCCCC(=O)OCc1cc(F)ccc1Br |
| InChI | InChI=1S/C21H30BrFO4/c1-16(2)14-26-20(24)9-7-5-3-4-6-8-10-21(25)27-15-17-13-18(23)11-12-19(17)22/h11-13,16H,3-10,14-15H2,1-2H3 |
| InChIKey | VNYSBCAEGAJWQH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate?
The IUPAC name of 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate (CID 91729054) is 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate.
What is the SMILES notation for 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate?
The canonical SMILES for 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate is CC(C)COC(=O)CCCCCCCCC(=O)OCc1cc(F)ccc1Br.
What is the InChIKey of 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate?
The InChIKey is VNYSBCAEGAJWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30BrFO4/c1-16(2)14-26-20(24)9-7-5-3-4-6-8-10-21(25)27-15-17-13-18(23)11-12-19(17)22/h11-13,16H,3-10,14-15H2,1-2H3.
What are the key properties of 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate?
1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate has a molecular weight of 445.37 g/mol, XLogP of 5.95, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(2-bromo-5-fluorophenyl)methyl] 10-O-(2-methylpropyl) decanedioate is sourced from PubChem (CID 91729054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).