C22H30Cl4O4 — CID 91729363
1-O-hexyl 10-O-(2,3,5,6-tetrachlorophenyl) decanedioate (PubChem CID 91729363) has the molecular formula C22H30Cl4O4 and a molecular weight of 500.29 g/mol. Its IUPAC name is 1-O-hexyl 10-O-(2,3,5,6-tetrachlorophenyl) decanedioate.
| Compound Name | 1-O-hexyl 10-O-(2,3,5,6-tetrachlorophenyl) decanedioate |
|---|---|
| PubChem CID | 91729363 |
| Molecular Formula | C22H30Cl4O4 |
| Molecular Weight | 500.29 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 1-O-hexyl 10-O-(2,3,5,6-tetrachlorophenyl) decanedioate |
| SMILES | CCCCCCOC(=O)CCCCCCCCC(=O)Oc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C22H30Cl4O4/c1-2-3-4-11-14-29-18(27)12-9-7-5-6-8-10-13-19(28)30-22-20(25)16(23)15-17(24)21(22)26/h15H,2-14H2,1H3 |
| InChIKey | IRIJTHQPBYIEGU-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.29 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|