C22H29F5O4 — CID 91729629
1-O-(4-methylpentyl) 10-O-(2,3,4,5,6-pentafluorophenyl) decanedioate (PubChem CID 91729629) has the molecular formula C22H29F5O4 and a molecular weight of 452.46 g/mol. Its IUPAC name is 1-O-(4-methylpentyl) 10-O-(2,3,4,5,6-pentafluorophenyl) decanedioate.
| Compound Name | 1-O-(4-methylpentyl) 10-O-(2,3,4,5,6-pentafluorophenyl) decanedioate |
|---|---|
| PubChem CID | 91729629 |
| Molecular Formula | C22H29F5O4 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-O-(4-methylpentyl) 10-O-(2,3,4,5,6-pentafluorophenyl) decanedioate |
| SMILES | CC(C)CCCOC(=O)CCCCCCCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H29F5O4/c1-14(2)10-9-13-30-15(28)11-7-5-3-4-6-8-12-16(29)31-22-20(26)18(24)17(23)19(25)21(22)27/h14H,3-13H2,1-2H3 |
| InChIKey | QGXFWBAGVGANKE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|