C11H26O2Si — CID 91730321
2,2-dimethylpropoxy-ethoxy-diethylsilane (PubChem CID 91730321) has the molecular formula C11H26O2Si and a molecular weight of 218.41 g/mol. Its IUPAC name is 2,2-dimethylpropoxy-ethoxy-diethylsilane.
| Compound Name | 2,2-dimethylpropoxy-ethoxy-diethylsilane |
|---|---|
| PubChem CID | 91730321 |
| Molecular Formula | C11H26O2Si |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2,2-dimethylpropoxy-ethoxy-diethylsilane |
| SMILES | CCO[Si](CC)(CC)OCC(C)(C)C |
| InChI | InChI=1S/C11H26O2Si/c1-7-12-14(8-2,9-3)13-10-11(4,5)6/h7-10H2,1-6H3 |
| InChIKey | OFCNJZFNCIGXLM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|