C10H14F5NO3 — CID 91730512
2-methylpropyl 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate (PubChem CID 91730512) has the molecular formula C10H14F5NO3 and a molecular weight of 291.22 g/mol. Its IUPAC name is 2-methylpropyl 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate.
| Compound Name | 2-methylpropyl 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate |
|---|---|
| PubChem CID | 91730512 |
| Molecular Formula | C10H14F5NO3 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-methylpropyl 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]acetate |
| SMILES | CC(C)COC(=O)CN(C)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F5NO3/c1-6(2)5-19-7(17)4-16(3)8(18)9(11,12)10(13,14)15/h6H,4-5H2,1-3H3 |
| InChIKey | XDOPAQNMLRSEOO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|