C16H12F4O2 — CID 91731514
(3,4-dimethylphenyl) 2-fluoro-6-(trifluoromethyl)benzoate (PubChem CID 91731514) has the molecular formula C16H12F4O2 and a molecular weight of 312.26 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 2-fluoro-6-(trifluoromethyl)benzoate.
| Compound Name | (3,4-dimethylphenyl) 2-fluoro-6-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 91731514 |
| Molecular Formula | C16H12F4O2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (3,4-dimethylphenyl) 2-fluoro-6-(trifluoromethyl)benzoate |
| SMILES | Cc1ccc(OC(=O)c2c(F)cccc2C(F)(F)F)cc1C |
| InChI | InChI=1S/C16H12F4O2/c1-9-6-7-11(8-10(9)2)22-15(21)14-12(16(18,19)20)4-3-5-13(14)17/h3-8H,1-2H3 |
| InChIKey | FKXZGSHVIMZONQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|