About (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate
(2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate (PubChem CID 91731557) has the molecular formula C20H12F4O2
and a molecular weight of 360.31 g/mol. Its IUPAC name is (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate |
| PubChem CID | 91731557 |
| Molecular Formula | C20H12F4O2 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate |
| SMILES | O=C(Oc1ccccc1-c1ccccc1)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C20H12F4O2/c21-17-12-14(10-11-16(17)20(22,23)24)19(25)26-18-9-5-4-8-15(18)13-6-2-1-3-7-13/h1-12H |
| InChIKey | OLNHTXPHXHGXKR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate?
The IUPAC name of (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate (CID 91731557) is (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate.
What is the SMILES notation for (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate?
The canonical SMILES for (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate is O=C(Oc1ccccc1-c1ccccc1)c1ccc(C(F)(F)F)c(F)c1.
What is the InChIKey of (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate?
The InChIKey is OLNHTXPHXHGXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F4O2/c21-17-12-14(10-11-16(17)20(22,23)24)19(25)26-18-9-5-4-8-15(18)13-6-2-1-3-7-13/h1-12H.
What are the key properties of (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate?
(2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate has a molecular weight of 360.31 g/mol, XLogP of 5.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylphenyl) 3-fluoro-4-(trifluoromethyl)benzoate is sourced from PubChem (CID 91731557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).