C19H26N2O8 — CID 91731851
1-O-heptyl 4-O-[(2-methyl-3,5-dinitrophenyl)methyl] butanedioate (PubChem CID 91731851) has the molecular formula C19H26N2O8 and a molecular weight of 410.42 g/mol. Its IUPAC name is 1-O-heptyl 4-O-[(2-methyl-3,5-dinitrophenyl)methyl] butanedioate.
| Compound Name | 1-O-heptyl 4-O-[(2-methyl-3,5-dinitrophenyl)methyl] butanedioate |
|---|---|
| PubChem CID | 91731851 |
| Molecular Formula | C19H26N2O8 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-O-heptyl 4-O-[(2-methyl-3,5-dinitrophenyl)methyl] butanedioate |
| SMILES | CCCCCCCOC(=O)CCC(=O)OCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C19H26N2O8/c1-3-4-5-6-7-10-28-18(22)8-9-19(23)29-13-15-11-16(20(24)25)12-17(14(15)2)21(26)27/h11-12H,3-10,13H2,1-2H3 |
| InChIKey | XJXGJUSOMNJDCR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|