C13H5BrCl6N4 — CID 91731896
N'-(2,4,6-trichloroanilino)-N-(2,4,6-trichlorophenyl)iminocarbamimidoyl bromide (PubChem CID 91731896) has the molecular formula C13H5BrCl6N4 and a molecular weight of 509.83 g/mol. Its IUPAC name is N'-(2,4,6-trichloroanilino)-N-(2,4,6-trichlorophenyl)iminocarbamimidoyl bromide.
| Compound Name | N'-(2,4,6-trichloroanilino)-N-(2,4,6-trichlorophenyl)iminocarbamimidoyl bromide |
|---|---|
| PubChem CID | 91731896 |
| Molecular Formula | C13H5BrCl6N4 |
| Molecular Weight | 509.83 g/mol |
| Exact Mass | 505.78 |
| IUPAC Name | N'-(2,4,6-trichloroanilino)-N-(2,4,6-trichlorophenyl)iminocarbamimidoyl bromide |
| SMILES | Clc1cc(Cl)c(/N=N/C(Br)=N\Nc2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H5BrCl6N4/c14-13(23-21-11-7(17)1-5(15)2-8(11)18)24-22-12-9(19)3-6(16)4-10(12)20/h1-4,21H/b23-13-,24-22+ |
| InChIKey | XSNMPDOMVZWZQK-OUEWFUSSSA-N |
| XLogP | 8.47 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.83 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|