C16H12F3NO — CID 91731908
1-(1,8-dimethylcarbazol-9-yl)-2,2,2-trifluoroethanone (PubChem CID 91731908) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 1-(1,8-dimethylcarbazol-9-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1,8-dimethylcarbazol-9-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 91731908 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-(1,8-dimethylcarbazol-9-yl)-2,2,2-trifluoroethanone |
| SMILES | Cc1cccc2c3cccc(C)c3n(C(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C16H12F3NO/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)20(13(9)11)15(21)16(17,18)19/h3-8H,1-2H3 |
| InChIKey | KUVUOVQLDXATDV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |