C13H8Cl3F3O4 — CID 91731963
1-O-(2,4,6-trichlorophenyl) 4-O-(1,1,1-trifluoropropan-2-yl) (E)-but-2-enedioate (PubChem CID 91731963) has the molecular formula C13H8Cl3F3O4 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-O-(2,4,6-trichlorophenyl) 4-O-(1,1,1-trifluoropropan-2-yl) (E)-but-2-enedioate.
| Compound Name | 1-O-(2,4,6-trichlorophenyl) 4-O-(1,1,1-trifluoropropan-2-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91731963 |
| Molecular Formula | C13H8Cl3F3O4 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 1-O-(2,4,6-trichlorophenyl) 4-O-(1,1,1-trifluoropropan-2-yl) (E)-but-2-enedioate |
| SMILES | CC(OC(=O)/C=C/C(=O)Oc1c(Cl)cc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C13H8Cl3F3O4/c1-6(13(17,18)19)22-10(20)2-3-11(21)23-12-8(15)4-7(14)5-9(12)16/h2-6H,1H3/b3-2+ |
| InChIKey | QICJDILZYKHBSN-NSCUHMNNSA-N |
| XLogP | 4.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|