C24H12F10O4 — CID 91732043
bis[1-(2,3,4,5,6-pentafluorophenyl)ethyl] benzene-1,4-dicarboxylate (PubChem CID 91732043) has the molecular formula C24H12F10O4 and a molecular weight of 554.34 g/mol. Its IUPAC name is bis[1-(2,3,4,5,6-pentafluorophenyl)ethyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[1-(2,3,4,5,6-pentafluorophenyl)ethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91732043 |
| Molecular Formula | C24H12F10O4 |
| Molecular Weight | 554.34 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | bis[1-(2,3,4,5,6-pentafluorophenyl)ethyl] benzene-1,4-dicarboxylate |
| SMILES | CC(OC(=O)c1ccc(C(=O)OC(C)c2c(F)c(F)c(F)c(F)c2F)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H12F10O4/c1-7(11-13(25)17(29)21(33)18(30)14(11)26)37-23(35)9-3-5-10(6-4-9)24(36)38-8(2)12-15(27)19(31)22(34)20(32)16(12)28/h3-8H,1-2H3 |
| InChIKey | VTXNWHSDQPMDLB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.34 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|