C19H11F10NO2 — CID 91732055
2,3,4,5,6-pentafluoro-N-(3-methylbutyl)-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide (PubChem CID 91732055) has the molecular formula C19H11F10NO2 and a molecular weight of 475.28 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(3-methylbutyl)-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(3-methylbutyl)-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide |
|---|---|
| PubChem CID | 91732055 |
| Molecular Formula | C19H11F10NO2 |
| Molecular Weight | 475.28 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(3-methylbutyl)-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide |
| SMILES | CC(C)CCN(C(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H11F10NO2/c1-5(2)3-4-30(18(31)6-8(20)12(24)16(28)13(25)9(6)21)19(32)7-10(22)14(26)17(29)15(27)11(7)23/h5H,3-4H2,1-2H3 |
| InChIKey | YPAMBHXPKREJHR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.28 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|