C21H15F10NO2 — CID 91732058
2,3,4,5,6-pentafluoro-N-heptan-2-yl-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide (PubChem CID 91732058) has the molecular formula C21H15F10NO2 and a molecular weight of 503.34 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-heptan-2-yl-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-heptan-2-yl-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide |
|---|---|
| PubChem CID | 91732058 |
| Molecular Formula | C21H15F10NO2 |
| Molecular Weight | 503.34 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-heptan-2-yl-N-(2,3,4,5,6-pentafluorobenzoyl)benzamide |
| SMILES | CCCCCC(C)N(C(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H15F10NO2/c1-3-4-5-6-7(2)32(20(33)8-10(22)14(26)18(30)15(27)11(8)23)21(34)9-12(24)16(28)19(31)17(29)13(9)25/h7H,3-6H2,1-2H3 |
| InChIKey | RMXPTMQXWDOHHZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|