C25H27F5O4 — CID 91732168
1-O-nonyl 4-O-[1-(2,3,4,5,6-pentafluorophenyl)ethyl] benzene-1,4-dicarboxylate (PubChem CID 91732168) has the molecular formula C25H27F5O4 and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-O-nonyl 4-O-[1-(2,3,4,5,6-pentafluorophenyl)ethyl] benzene-1,4-dicarboxylate.
| Compound Name | 1-O-nonyl 4-O-[1-(2,3,4,5,6-pentafluorophenyl)ethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91732168 |
| Molecular Formula | C25H27F5O4 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-O-nonyl 4-O-[1-(2,3,4,5,6-pentafluorophenyl)ethyl] benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1ccc(C(=O)OC(C)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H27F5O4/c1-3-4-5-6-7-8-9-14-33-24(31)16-10-12-17(13-11-16)25(32)34-15(2)18-19(26)21(28)23(30)22(29)20(18)27/h10-13,15H,3-9,14H2,1-2H3 |
| InChIKey | ZOUJPPXNBAMFKD-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|