C14H19F3O4 — CID 91732378
4-O-hepta-1,6-dien-4-yl 1-O-(1,1,1-trifluoropropan-2-yl) butanedioate (PubChem CID 91732378) has the molecular formula C14H19F3O4 and a molecular weight of 308.30 g/mol. Its IUPAC name is 4-O-hepta-1,6-dien-4-yl 1-O-(1,1,1-trifluoropropan-2-yl) butanedioate.
| Compound Name | 4-O-hepta-1,6-dien-4-yl 1-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
|---|---|
| PubChem CID | 91732378 |
| Molecular Formula | C14H19F3O4 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 4-O-hepta-1,6-dien-4-yl 1-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
| SMILES | C=CCC(CC=C)OC(=O)CCC(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C14H19F3O4/c1-4-6-11(7-5-2)21-13(19)9-8-12(18)20-10(3)14(15,16)17/h4-5,10-11H,1-2,6-9H2,3H3 |
| InChIKey | JKORLBFFGDBXNW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|