C28H42O2Si — CID 91732645
(3,5-dimethylcyclohexyl)oxy-octoxy-diphenylsilane (PubChem CID 91732645) has the molecular formula C28H42O2Si and a molecular weight of 438.73 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)oxy-octoxy-diphenylsilane.
| Compound Name | (3,5-dimethylcyclohexyl)oxy-octoxy-diphenylsilane |
|---|---|
| PubChem CID | 91732645 |
| Molecular Formula | C28H42O2Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (3,5-dimethylcyclohexyl)oxy-octoxy-diphenylsilane |
| SMILES | CCCCCCCCO[Si](OC1CC(C)CC(C)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H42O2Si/c1-4-5-6-7-8-15-20-29-31(27-16-11-9-12-17-27,28-18-13-10-14-19-28)30-26-22-24(2)21-25(3)23-26/h9-14,16-19,24-26H,4-8,15,20-23H2,1-3H3 |
| InChIKey | UTXJICDJGJMJJL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|