About nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane
nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (PubChem CID 91733045) has the molecular formula C24H33F3O2Si
and a molecular weight of 438.61 g/mol. Its IUPAC name is nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
Molecular Properties
| Compound Name | nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| PubChem CID | 91733045 |
| Molecular Formula | C24H33F3O2Si |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| SMILES | CCCCCCCCCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33F3O2Si/c1-3-4-5-6-7-8-15-20-28-30(22-16-11-9-12-17-22,23-18-13-10-14-19-23)29-21(2)24(25,26)27/h9-14,16-19,21H,3-8,15,20H2,1-2H3 |
| InChIKey | GHWLRSMRPGXCED-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The IUPAC name of nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (CID 91733045) is nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
What is the SMILES notation for nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The canonical SMILES for nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane is CCCCCCCCCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The InChIKey is GHWLRSMRPGXCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33F3O2Si/c1-3-4-5-6-7-8-15-20-28-30(22-16-11-9-12-17-22,23-18-13-10-14-19-23)29-21(2)24(25,26)27/h9-14,16-19,21H,3-8,15,20H2,1-2H3.
What are the key properties of nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane has a molecular weight of 438.61 g/mol, XLogP of 5.98, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane is sourced from PubChem (CID 91733045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).