C21H25F5O2Si — CID 91733065
4-methylpentoxy-(2,2,3,3,3-pentafluoropropoxy)-diphenylsilane (PubChem CID 91733065) has the molecular formula C21H25F5O2Si and a molecular weight of 432.51 g/mol. Its IUPAC name is 4-methylpentoxy-(2,2,3,3,3-pentafluoropropoxy)-diphenylsilane.
| Compound Name | 4-methylpentoxy-(2,2,3,3,3-pentafluoropropoxy)-diphenylsilane |
|---|---|
| PubChem CID | 91733065 |
| Molecular Formula | C21H25F5O2Si |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-methylpentoxy-(2,2,3,3,3-pentafluoropropoxy)-diphenylsilane |
| SMILES | CC(C)CCCO[Si](OCC(F)(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25F5O2Si/c1-17(2)10-9-15-27-29(18-11-5-3-6-12-18,19-13-7-4-8-14-19)28-16-20(22,23)21(24,25)26/h3-8,11-14,17H,9-10,15-16H2,1-2H3 |
| InChIKey | CHNSAUSNKXXQDB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|