About decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane
decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (PubChem CID 91733074) has the molecular formula C25H35F3O2Si
and a molecular weight of 452.63 g/mol. Its IUPAC name is decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
Molecular Properties
| Compound Name | decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| PubChem CID | 91733074 |
| Molecular Formula | C25H35F3O2Si |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| SMILES | CCCCCCCCCCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35F3O2Si/c1-3-4-5-6-7-8-9-16-21-29-31(23-17-12-10-13-18-23,24-19-14-11-15-20-24)30-22(2)25(26,27)28/h10-15,17-20,22H,3-9,16,21H2,1-2H3 |
| InChIKey | LXZLUBFXPQEVSA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The IUPAC name of decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (CID 91733074) is decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
What is the SMILES notation for decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The canonical SMILES for decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane is CCCCCCCCCCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The InChIKey is LXZLUBFXPQEVSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35F3O2Si/c1-3-4-5-6-7-8-9-16-21-29-31(23-17-12-10-13-18-23,24-19-14-11-15-20-24)30-22(2)25(26,27)28/h10-15,17-20,22H,3-9,16,21H2,1-2H3.
What are the key properties of decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane has a molecular weight of 452.63 g/mol, XLogP of 6.37, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane is sourced from PubChem (CID 91733074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).