About heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane
heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (PubChem CID 91733094) has the molecular formula C22H29F3O2Si
and a molecular weight of 410.55 g/mol. Its IUPAC name is heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
Molecular Properties
| Compound Name | heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| PubChem CID | 91733094 |
| Molecular Formula | C22H29F3O2Si |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| SMILES | CCCCCCCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29F3O2Si/c1-3-4-5-6-13-18-26-28(20-14-9-7-10-15-20,21-16-11-8-12-17-21)27-19(2)22(23,24)25/h7-12,14-17,19H,3-6,13,18H2,1-2H3 |
| InChIKey | MSJNSTPIYWOXDX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The IUPAC name of heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (CID 91733094) is heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
What is the SMILES notation for heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The canonical SMILES for heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane is CCCCCCCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
The InChIKey is MSJNSTPIYWOXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29F3O2Si/c1-3-4-5-6-13-18-26-28(20-14-9-7-10-15-20,21-16-11-8-12-17-21)27-19(2)22(23,24)25/h7-12,14-17,19H,3-6,13,18H2,1-2H3.
What are the key properties of heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane?
heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane has a molecular weight of 410.55 g/mol, XLogP of 5.20, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane is sourced from PubChem (CID 91733094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).