C19H22F4O2Si — CID 91733111
2-methylpropoxy-diphenyl-(2,2,3,3-tetrafluoropropoxy)silane (PubChem CID 91733111) has the molecular formula C19H22F4O2Si and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-methylpropoxy-diphenyl-(2,2,3,3-tetrafluoropropoxy)silane.
| Compound Name | 2-methylpropoxy-diphenyl-(2,2,3,3-tetrafluoropropoxy)silane |
|---|---|
| PubChem CID | 91733111 |
| Molecular Formula | C19H22F4O2Si |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-methylpropoxy-diphenyl-(2,2,3,3-tetrafluoropropoxy)silane |
| SMILES | CC(C)CO[Si](OCC(F)(F)C(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22F4O2Si/c1-15(2)13-24-26(16-9-5-3-6-10-16,17-11-7-4-8-12-17)25-14-19(22,23)18(20)21/h3-12,15,18H,13-14H2,1-2H3 |
| InChIKey | DZTJZCNBKHHEBS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|