C19H21F5O2Si — CID 91733114
2-methylpropoxy-(2,2,3,3,3-pentafluoropropoxy)-diphenylsilane (PubChem CID 91733114) has the molecular formula C19H21F5O2Si and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-methylpropoxy-(2,2,3,3,3-pentafluoropropoxy)-diphenylsilane.
| Compound Name | 2-methylpropoxy-(2,2,3,3,3-pentafluoropropoxy)-diphenylsilane |
|---|---|
| PubChem CID | 91733114 |
| Molecular Formula | C19H21F5O2Si |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-methylpropoxy-(2,2,3,3,3-pentafluoropropoxy)-diphenylsilane |
| SMILES | CC(C)CO[Si](OCC(F)(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21F5O2Si/c1-15(2)13-25-27(16-9-5-3-6-10-16,17-11-7-4-8-12-17)26-14-18(20,21)19(22,23)24/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | FKEJIIBGOAKQOO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|