C9H5F10NO2 — CID 91733201
2,2,3,3,3-pentafluoro-N-(2,2,3,3,3-pentafluoropropanoyl)-N-prop-2-enylpropanamide (PubChem CID 91733201) has the molecular formula C9H5F10NO2 and a molecular weight of 349.12 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(2,2,3,3,3-pentafluoropropanoyl)-N-prop-2-enylpropanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(2,2,3,3,3-pentafluoropropanoyl)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 91733201 |
| Molecular Formula | C9H5F10NO2 |
| Molecular Weight | 349.12 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(2,2,3,3,3-pentafluoropropanoyl)-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C(=O)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F10NO2/c1-2-3-20(4(21)6(10,11)8(14,15)16)5(22)7(12,13)9(17,18)19/h2H,1,3H2 |
| InChIKey | RMFCXIGGISTQRR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|