C30H58O5Si3 — CID 91733260
methyl (7E,9E,11Z,13E)-5,6,15-tris(trimethylsilyloxy)icosa-7,9,11,13-tetraenoate (PubChem CID 91733260) has the molecular formula C30H58O5Si3 and a molecular weight of 583.05 g/mol. Its IUPAC name is methyl (7E,9E,11Z,13E)-5,6,15-tris(trimethylsilyloxy)icosa-7,9,11,13-tetraenoate.
| Compound Name | methyl (7E,9E,11Z,13E)-5,6,15-tris(trimethylsilyloxy)icosa-7,9,11,13-tetraenoate |
|---|---|
| PubChem CID | 91733260 |
| Molecular Formula | C30H58O5Si3 |
| Molecular Weight | 583.05 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | methyl (7E,9E,11Z,13E)-5,6,15-tris(trimethylsilyloxy)icosa-7,9,11,13-tetraenoate |
| SMILES | CCCCCC(/C=C/C=C\C=C\C=C\C(O[Si](C)(C)C)C(CCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H58O5Si3/c1-12-13-18-22-27(33-36(3,4)5)23-19-16-14-15-17-20-24-28(34-37(6,7)8)29(35-38(9,10)11)25-21-26-30(31)32-2/h14-17,19-20,23-24,27-29H,12-13,18,21-22,25-26H2,1-11H3/b16-14-,17-15+,23-19+,24-20+ |
| InChIKey | KJAUCXLZFNVUTA-YDYYVGSBSA-N |
| XLogP | 8.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.05 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|