C33H56O2Si — CID 91733318
1,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carbaldehyde (PubChem CID 91733318) has the molecular formula C33H56O2Si and a molecular weight of 512.90 g/mol. Its IUPAC name is 1,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carbaldehyde.
| Compound Name | 1,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carbaldehyde |
|---|---|
| PubChem CID | 91733318 |
| Molecular Formula | C33H56O2Si |
| Molecular Weight | 512.90 g/mol |
| Exact Mass | 512.40 |
| IUPAC Name | 1,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carbaldehyde |
| SMILES | CC1CCC2(C=O)CCC3(C)C(=CCC4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C33H56O2Si/c1-22-13-18-33(21-34)20-19-31(6)24(28(33)23(22)2)11-12-26-30(5)16-15-27(35-36(8,9)10)29(3,4)25(30)14-17-32(26,31)7/h11,21-23,25-28H,12-20H2,1-10H3 |
| InChIKey | DPRCZECAUZRWCQ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.90 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|