C27H52O4Si2 — CID 91733327
methyl (8Z,11Z,14Z)-5,6-bis(trimethylsilyloxy)icosa-8,11,14-trienoate (PubChem CID 91733327) has the molecular formula C27H52O4Si2 and a molecular weight of 496.88 g/mol. Its IUPAC name is methyl (8Z,11Z,14Z)-5,6-bis(trimethylsilyloxy)icosa-8,11,14-trienoate.
| Compound Name | methyl (8Z,11Z,14Z)-5,6-bis(trimethylsilyloxy)icosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 91733327 |
| Molecular Formula | C27H52O4Si2 |
| Molecular Weight | 496.88 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | methyl (8Z,11Z,14Z)-5,6-bis(trimethylsilyloxy)icosa-8,11,14-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC(O[Si](C)(C)C)C(CCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C27H52O4Si2/c1-9-10-11-12-13-14-15-16-17-18-19-20-22-25(30-32(3,4)5)26(31-33(6,7)8)23-21-24-27(28)29-2/h13-14,16-17,19-20,25-26H,9-12,15,18,21-24H2,1-8H3/b14-13-,17-16-,20-19- |
| InChIKey | JRJSTBGSBZJNCN-BYBPBHJYSA-N |
| XLogP | 8.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.88 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|