C15H18F5NO2 — CID 91733394
2,2,3,3,3-pentafluoro-N-[1-(3-methoxy-5-methylphenyl)propan-2-yl]-N-methylpropanamide (PubChem CID 91733394) has the molecular formula C15H18F5NO2 and a molecular weight of 339.30 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[1-(3-methoxy-5-methylphenyl)propan-2-yl]-N-methylpropanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[1-(3-methoxy-5-methylphenyl)propan-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 91733394 |
| Molecular Formula | C15H18F5NO2 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[1-(3-methoxy-5-methylphenyl)propan-2-yl]-N-methylpropanamide |
| SMILES | COc1cc(C)cc(CC(C)N(C)C(=O)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F5NO2/c1-9-5-11(8-12(6-9)23-4)7-10(2)21(3)13(22)14(16,17)15(18,19)20/h5-6,8,10H,7H2,1-4H3 |
| InChIKey | XCWZQIRTQHYMKJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|