C19H19FO5 — CID 91733630
1-O-butyl 4-O-(4-fluoro-2-methoxyphenyl) benzene-1,4-dicarboxylate (PubChem CID 91733630) has the molecular formula C19H19FO5 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1-O-butyl 4-O-(4-fluoro-2-methoxyphenyl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-butyl 4-O-(4-fluoro-2-methoxyphenyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91733630 |
| Molecular Formula | C19H19FO5 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-O-butyl 4-O-(4-fluoro-2-methoxyphenyl) benzene-1,4-dicarboxylate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)Oc2ccc(F)cc2OC)cc1 |
| InChI | InChI=1S/C19H19FO5/c1-3-4-11-24-18(21)13-5-7-14(8-6-13)19(22)25-16-10-9-15(20)12-17(16)23-2/h5-10,12H,3-4,11H2,1-2H3 |
| InChIKey | OWPZJHVFZZTKDM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|