C23H30O6 — CID 91734155
1,3-dimethoxy-5-prop-2-enyl-2-[(2S)-1-(3,4,5-trimethoxyphenyl)propan-2-yl]oxybenzene (PubChem CID 91734155) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1,3-dimethoxy-5-prop-2-enyl-2-[(2S)-1-(3,4,5-trimethoxyphenyl)propan-2-yl]oxybenzene.
| Compound Name | 1,3-dimethoxy-5-prop-2-enyl-2-[(2S)-1-(3,4,5-trimethoxyphenyl)propan-2-yl]oxybenzene |
|---|---|
| PubChem CID | 91734155 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 1,3-dimethoxy-5-prop-2-enyl-2-[(2S)-1-(3,4,5-trimethoxyphenyl)propan-2-yl]oxybenzene |
| SMILES | C=CCc1cc(OC)c(O[C@@H](C)Cc2cc(OC)c(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C23H30O6/c1-8-9-16-11-20(26-5)23(21(12-16)27-6)29-15(2)10-17-13-18(24-3)22(28-7)19(14-17)25-4/h8,11-15H,1,9-10H2,2-7H3/t15-/m0/s1 |
| InChIKey | ZOPUPXKPXCSWAE-HNNXBMFYSA-N |
| XLogP | 4.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|