About 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate
1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate (PubChem CID 91734302) has the molecular formula C13H19F3O4
and a molecular weight of 296.28 g/mol. Its IUPAC name is 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate.
Molecular Properties
| Compound Name | 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
| PubChem CID | 91734302 |
| Molecular Formula | C13H19F3O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
| SMILES | CC/C=C/COC(=O)CCCC(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C13H19F3O4/c1-3-4-5-9-19-11(17)7-6-8-12(18)20-10(2)13(14,15)16/h4-5,10H,3,6-9H2,1-2H3/b5-4+ |
| InChIKey | KKKVVKOMSZVLEC-SNAWJCMRSA-N |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate?
The IUPAC name of 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate (CID 91734302) is 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate.
What is the SMILES notation for 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate?
The canonical SMILES for 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate is CC/C=C/COC(=O)CCCC(=O)OC(C)C(F)(F)F.
What is the InChIKey of 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate?
The InChIKey is KKKVVKOMSZVLEC-SNAWJCMRSA-N. The full InChI is InChI=1S/C13H19F3O4/c1-3-4-5-9-19-11(17)7-6-8-12(18)20-10(2)13(14,15)16/h4-5,10H,3,6-9H2,1-2H3/b5-4+.
What are the key properties of 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate?
1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate has a molecular weight of 296.28 g/mol, XLogP of 3.16, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(E)-pent-2-enyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate is sourced from PubChem (CID 91734302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).