C17H21F3O4 — CID 91734339
1-O-(2-propylphenyl) 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate (PubChem CID 91734339) has the molecular formula C17H21F3O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 1-O-(2-propylphenyl) 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate.
| Compound Name | 1-O-(2-propylphenyl) 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
|---|---|
| PubChem CID | 91734339 |
| Molecular Formula | C17H21F3O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-O-(2-propylphenyl) 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
| SMILES | CCCc1ccccc1OC(=O)CCCC(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C17H21F3O4/c1-3-7-13-8-4-5-9-14(13)24-16(22)11-6-10-15(21)23-12(2)17(18,19)20/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3 |
| InChIKey | TYCVVWURQPREGP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|