C14H18FNO — CID 917347
3-cyclopentyl-N-(2-fluorophenyl)propanamide (PubChem CID 917347) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-cyclopentyl-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-cyclopentyl-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 917347 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-cyclopentyl-N-(2-fluorophenyl)propanamide |
| SMILES | O=C(CCC1CCCC1)Nc1ccccc1F |
| InChI | InChI=1S/C14H18FNO/c15-12-7-3-4-8-13(12)16-14(17)10-9-11-5-1-2-6-11/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,16,17) |
| InChIKey | IAEASDQMRNTREN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |