C14H18F4O4 — CID 91734880
4-O-hepta-1,6-dien-4-yl 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91734880) has the molecular formula C14H18F4O4 and a molecular weight of 326.29 g/mol. Its IUPAC name is 4-O-hepta-1,6-dien-4-yl 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 4-O-hepta-1,6-dien-4-yl 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91734880 |
| Molecular Formula | C14H18F4O4 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-O-hepta-1,6-dien-4-yl 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | C=CCC(CC=C)OC(=O)CCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H18F4O4/c1-3-5-10(6-4-2)22-12(20)8-7-11(19)21-9-14(17,18)13(15)16/h3-4,10,13H,1-2,5-9H2 |
| InChIKey | XJHNOORFJYSALI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|