C13H20F4O4 — CID 91734926
4-O-(4-methylpentan-2-yl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91734926) has the molecular formula C13H20F4O4 and a molecular weight of 316.29 g/mol. Its IUPAC name is 4-O-(4-methylpentan-2-yl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 4-O-(4-methylpentan-2-yl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91734926 |
| Molecular Formula | C13H20F4O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-O-(4-methylpentan-2-yl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | CC(C)CC(C)OC(=O)CCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H20F4O4/c1-8(2)6-9(3)21-11(19)5-4-10(18)20-7-13(16,17)12(14)15/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | GEODVOPZSUCSPA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|