About chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane
chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane (PubChem CID 91735033) has the molecular formula C14H25ClOSi
and a molecular weight of 272.89 g/mol. Its IUPAC name is chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane.
Molecular Properties
| Compound Name | chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane |
| PubChem CID | 91735033 |
| Molecular Formula | C14H25ClOSi |
| Molecular Weight | 272.89 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane |
| SMILES | C=C(C)C#CC(CC(C)C)O[Si](Cl)(CC)CC |
| InChI | InChI=1S/C14H25ClOSi/c1-7-17(15,8-2)16-14(11-13(5)6)10-9-12(3)4/h13-14H,3,7-8,11H2,1-2,4-6H3 |
| InChIKey | XHSAWSZFZLNXGX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.89 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane?
The IUPAC name of chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane (CID 91735033) is chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane.
What is the SMILES notation for chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane?
The canonical SMILES for chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane is C=C(C)C#CC(CC(C)C)O[Si](Cl)(CC)CC.
What is the InChIKey of chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane?
The InChIKey is XHSAWSZFZLNXGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25ClOSi/c1-7-17(15,8-2)16-14(11-13(5)6)10-9-12(3)4/h13-14H,3,7-8,11H2,1-2,4-6H3.
What are the key properties of chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane?
chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane has a molecular weight of 272.89 g/mol, XLogP of 4.72, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(2,7-dimethyloct-7-en-5-yn-4-yloxy)-diethylsilane is sourced from PubChem (CID 91735033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).