C33H58OSi — CID 91735356
(4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl)oxy-trimethylsilane (PubChem CID 91735356) has the molecular formula C33H58OSi and a molecular weight of 498.91 g/mol. Its IUPAC name is (4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl)oxy-trimethylsilane.
| Compound Name | (4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 91735356 |
| Molecular Formula | C33H58OSi |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.43 |
| IUPAC Name | (4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl)oxy-trimethylsilane |
| SMILES | CC1CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C33H58OSi/c1-22-14-17-30(5)20-21-32(7)24(28(30)23(22)2)12-13-26-31(6)18-16-27(34-35(9,10)11)29(3,4)25(31)15-19-33(26,32)8/h12,22-23,25-28H,13-21H2,1-11H3 |
| InChIKey | WTQGCUIIGTXDIX-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|