C17H28F5NO3 — CID 91735365
nonyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 91735365) has the molecular formula C17H28F5NO3 and a molecular weight of 389.41 g/mol. Its IUPAC name is nonyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | nonyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 91735365 |
| Molecular Formula | C17H28F5NO3 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | nonyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCCCCCCCCOC(=O)C(NC(=O)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C17H28F5NO3/c1-4-5-6-7-8-9-10-11-26-14(24)13(12(2)3)23-15(25)16(18,19)17(20,21)22/h12-13H,4-11H2,1-3H3,(H,23,25) |
| InChIKey | OSOLVSYVJHKPIN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|