C18H30F5NO3 — CID 91735366
decyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 91735366) has the molecular formula C18H30F5NO3 and a molecular weight of 403.43 g/mol. Its IUPAC name is decyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | decyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 91735366 |
| Molecular Formula | C18H30F5NO3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | decyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCCCCCCCCCOC(=O)C(NC(=O)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C18H30F5NO3/c1-4-5-6-7-8-9-10-11-12-27-15(25)14(13(2)3)24-16(26)17(19,20)18(21,22)23/h13-14H,4-12H2,1-3H3,(H,24,26) |
| InChIKey | CUQFTSBVZQBCFH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|