C15H24F5NO3S — CID 91735675
heptyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 91735675) has the molecular formula C15H24F5NO3S and a molecular weight of 393.42 g/mol. Its IUPAC name is heptyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | heptyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 91735675 |
| Molecular Formula | C15H24F5NO3S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | heptyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCCCCCCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H24F5NO3S/c1-3-4-5-6-7-9-24-12(22)11(8-10-25-2)21-13(23)14(16,17)15(18,19)20/h11H,3-10H2,1-2H3,(H,21,23) |
| InChIKey | KLWDJOCSFZRADF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|