C16H26F5NO3S — CID 91735754
octyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 91735754) has the molecular formula C16H26F5NO3S and a molecular weight of 407.45 g/mol. Its IUPAC name is octyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | octyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 91735754 |
| Molecular Formula | C16H26F5NO3S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | octyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCCCCCCCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H26F5NO3S/c1-3-4-5-6-7-8-10-25-13(23)12(9-11-26-2)22-14(24)15(17,18)16(19,20)21/h12H,3-11H2,1-2H3,(H,22,24) |
| InChIKey | XQLOQVWYMYTKAS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|