C17H28F5NO3S — CID 91735756
nonyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 91735756) has the molecular formula C17H28F5NO3S and a molecular weight of 421.47 g/mol. Its IUPAC name is nonyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | nonyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 91735756 |
| Molecular Formula | C17H28F5NO3S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | nonyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCCCCCCCCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H28F5NO3S/c1-3-4-5-6-7-8-9-11-26-14(24)13(10-12-27-2)23-15(25)16(18,19)17(20,21)22/h13H,3-12H2,1-2H3,(H,23,25) |
| InChIKey | XBLRLROWVPYLCX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|