C18H30F5NO3S — CID 91735758
decyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 91735758) has the molecular formula C18H30F5NO3S and a molecular weight of 435.50 g/mol. Its IUPAC name is decyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | decyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 91735758 |
| Molecular Formula | C18H30F5NO3S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | decyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCCCCCCCCCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H30F5NO3S/c1-3-4-5-6-7-8-9-10-12-27-15(25)14(11-13-28-2)24-16(26)17(19,20)18(21,22)23/h14H,3-13H2,1-2H3,(H,24,26) |
| InChIKey | IARFMHZEUTYHEI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|