C13H11F14NO3 — CID 91736094
5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)pentyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91736094) has the molecular formula C13H11F14NO3 and a molecular weight of 495.21 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)pentyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)pentyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91736094 |
| Molecular Formula | C13H11F14NO3 |
| Molecular Weight | 495.21 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 5-(2,2,3,3,4,4,4-heptafluorobutanoylamino)pentyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(NCCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F14NO3/c14-8(15,10(18,19)12(22,23)24)6(29)28-4-2-1-3-5-31-7(30)9(16,17)11(20,21)13(25,26)27/h1-5H2,(H,28,29) |
| InChIKey | HEZFPIJZTCUYDI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.21 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|